C17H23N3O2 — CID 138053095
2-(ethoxymethyl)-4-[2-(furan-2-yl)piperidin-1-yl]-6-methylpyrimidine (PubChem CID 138053095) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(ethoxymethyl)-4-[2-(furan-2-yl)piperidin-1-yl]-6-methylpyrimidine.
| Compound Name | 2-(ethoxymethyl)-4-[2-(furan-2-yl)piperidin-1-yl]-6-methylpyrimidine |
|---|---|
| PubChem CID | 138053095 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-(ethoxymethyl)-4-[2-(furan-2-yl)piperidin-1-yl]-6-methylpyrimidine |
| SMILES | CCOCc1nc(C)cc(N2CCCCC2c2ccco2)n1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-21-12-16-18-13(2)11-17(19-16)20-9-5-4-7-14(20)15-8-6-10-22-15/h6,8,10-11,14H,3-5,7,9,12H2,1-2H3 |
| InChIKey | LFBTWTYQXVCRBN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |