C18H20N4O — CID 138053604
2-(methoxymethyl)-6-methyl-N-(2-quinolin-3-ylethyl)pyrimidin-4-amine (PubChem CID 138053604) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-methyl-N-(2-quinolin-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 2-(methoxymethyl)-6-methyl-N-(2-quinolin-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 138053604 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-(methoxymethyl)-6-methyl-N-(2-quinolin-3-ylethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(C)cc(NCCc2cnc3ccccc3c2)n1 |
| InChI | InChI=1S/C18H20N4O/c1-13-9-17(22-18(21-13)12-23-2)19-8-7-14-10-15-5-3-4-6-16(15)20-11-14/h3-6,9-11H,7-8,12H2,1-2H3,(H,19,21,22) |
| InChIKey | PPGILOXYTUZSNQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |