C18H19N3O3 — CID 138053836
1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3-(6-phenoxy-2-pyridinyl)urea (PubChem CID 138053836) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3-(6-phenoxy-2-pyridinyl)urea.
| Compound Name | 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3-(6-phenoxy-2-pyridinyl)urea |
|---|---|
| PubChem CID | 138053836 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3-(6-phenoxy-2-pyridinyl)urea |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)n1)N[C@@H]1C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C18H19N3O3/c22-18(19-14-11-13-9-10-15(14)23-13)21-16-7-4-8-17(20-16)24-12-5-2-1-3-6-12/h1-8,13-15H,9-11H2,(H2,19,20,21,22)/t13-,14-,15+/m1/s1 |
| InChIKey | MNTAADDDAHAQBM-KFWWJZLASA-N |
| XLogP | 3.32 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |