C16H18FN3O3 — CID 138053849
1-[(2-fluoro-6-hydroxyphenyl)methyl]-3-(3-propan-2-yloxy-4-pyridinyl)urea (PubChem CID 138053849) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[(2-fluoro-6-hydroxyphenyl)methyl]-3-(3-propan-2-yloxy-4-pyridinyl)urea.
| Compound Name | 1-[(2-fluoro-6-hydroxyphenyl)methyl]-3-(3-propan-2-yloxy-4-pyridinyl)urea |
|---|---|
| PubChem CID | 138053849 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[(2-fluoro-6-hydroxyphenyl)methyl]-3-(3-propan-2-yloxy-4-pyridinyl)urea |
| SMILES | CC(C)Oc1cnccc1NC(=O)NCc1c(O)cccc1F |
| InChI | InChI=1S/C16H18FN3O3/c1-10(2)23-15-9-18-7-6-13(15)20-16(22)19-8-11-12(17)4-3-5-14(11)21/h3-7,9-10,21H,8H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | BOJLTEZFYFUWIS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|