C12H13BrN4OS — CID 138054455
1-(4-bromothiophen-3-yl)-3-(1-cyclobutylpyrazol-4-yl)urea (PubChem CID 138054455) has the molecular formula C12H13BrN4OS and a molecular weight of 341.23 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-3-(1-cyclobutylpyrazol-4-yl)urea.
| Compound Name | 1-(4-bromothiophen-3-yl)-3-(1-cyclobutylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 138054455 |
| Molecular Formula | C12H13BrN4OS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-3-(1-cyclobutylpyrazol-4-yl)urea |
| SMILES | O=C(Nc1cnn(C2CCC2)c1)Nc1cscc1Br |
| InChI | InChI=1S/C12H13BrN4OS/c13-10-6-19-7-11(10)16-12(18)15-8-4-14-17(5-8)9-2-1-3-9/h4-7,9H,1-3H2,(H2,15,16,18) |
| InChIKey | TYLQNXKHVLJDJS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |