C21H25N3O2 — CID 138057060
1-[(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl]-2-[2-(pyridin-4-ylmethoxy)phenyl]ethanone (PubChem CID 138057060) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl]-2-[2-(pyridin-4-ylmethoxy)phenyl]ethanone.
| Compound Name | 1-[(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl]-2-[2-(pyridin-4-ylmethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 138057060 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl]-2-[2-(pyridin-4-ylmethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1OCc1ccncc1)N1CCC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C21H25N3O2/c25-21(24-11-3-5-18-13-23-14-19(18)24)12-17-4-1-2-6-20(17)26-15-16-7-9-22-10-8-16/h1-2,4,6-10,18-19,23H,3,5,11-15H2/t18-,19+/m0/s1 |
| InChIKey | MBXGIXHFKCKNKE-RBUKOAKNSA-N |
| XLogP | 2.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |