C18H12FNO4 — CID 138105966
4-[2-(4-fluorophenyl)-5-hydroxy-6-oxo-1H-pyridin-3-yl]benzoic acid (PubChem CID 138105966) has the molecular formula C18H12FNO4 and a molecular weight of 325.30 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-5-hydroxy-6-oxo-1H-pyridin-3-yl]benzoic acid.
| Compound Name | 4-[2-(4-fluorophenyl)-5-hydroxy-6-oxo-1H-pyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 138105966 |
| Molecular Formula | C18H12FNO4 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-5-hydroxy-6-oxo-1H-pyridin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(O)c(=O)[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H12FNO4/c19-13-7-5-11(6-8-13)16-14(9-15(21)17(22)20-16)10-1-3-12(4-2-10)18(23)24/h1-9,21H,(H,20,22)(H,23,24) |
| InChIKey | ZTIFGKNOJZNMHX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |