C18H11FN2O2 — CID 123605385
6-(4-fluorophenyl)-3-hydroxy-5-(4-isocyanophenyl)-1H-pyridin-2-one (PubChem CID 123605385) has the molecular formula C18H11FN2O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-hydroxy-5-(4-isocyanophenyl)-1H-pyridin-2-one.
| Compound Name | 6-(4-fluorophenyl)-3-hydroxy-5-(4-isocyanophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123605385 |
| Molecular Formula | C18H11FN2O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 6-(4-fluorophenyl)-3-hydroxy-5-(4-isocyanophenyl)-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1ccc(-c2cc(O)c(=O)[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H11FN2O2/c1-20-14-8-4-11(5-9-14)15-10-16(22)18(23)21-17(15)12-2-6-13(19)7-3-12/h2-10,22H,(H,21,23) |
| InChIKey | MJAQQEQVBJVWKA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|