C7H15NO — CID 138108716
3-ethoxy-N,N-dimethylprop-2-en-1-amine (PubChem CID 138108716) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 3-ethoxy-N,N-dimethylprop-2-en-1-amine.
| Compound Name | 3-ethoxy-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 138108716 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 3-ethoxy-N,N-dimethylprop-2-en-1-amine |
| SMILES | CCOC=CCN(C)C |
| InChI | InChI=1S/C7H15NO/c1-4-9-7-5-6-8(2)3/h5,7H,4,6H2,1-3H3 |
| InChIKey | DKEUVYLDGMMDOH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|