C9H11Cl2NO2 — CID 138109176
2-amino-2-(2-chloro-3-methylphenyl)acetic acid;hydrochloride (PubChem CID 138109176) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-amino-2-(2-chloro-3-methylphenyl)acetic acid;hydrochloride.
| Compound Name | 2-amino-2-(2-chloro-3-methylphenyl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 138109176 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-amino-2-(2-chloro-3-methylphenyl)acetic acid;hydrochloride |
| SMILES | Cc1cccc(C(N)C(=O)O)c1Cl.Cl |
| InChI | InChI=1S/C9H10ClNO2.ClH/c1-5-3-2-4-6(7(5)10)8(11)9(12)13;/h2-4,8H,11H2,1H3,(H,12,13);1H |
| InChIKey | ZXBKQDBQRTZDFL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |