About 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol
2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol (PubChem CID 138113041) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol.
Molecular Properties
| Compound Name | 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol |
| PubChem CID | 138113041 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol |
| SMILES | COCc1ccccc1O.COc1ccccc1CO |
| InChI | InChI=1S/2C8H10O2/c1-10-6-7-4-2-3-5-8(7)9;1-10-8-5-3-2-4-7(8)6-9/h2*2-5,9H,6H2,1H3 |
| InChIKey | UMPADTCSEREANV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol?
The IUPAC name of 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol (CID 138113041) is 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol.
What is the SMILES notation for 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol?
The canonical SMILES for 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol is COCc1ccccc1O.COc1ccccc1CO.
What is the InChIKey of 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol?
The InChIKey is UMPADTCSEREANV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O2/c1-10-6-7-4-2-3-5-8(7)9;1-10-8-5-3-2-4-7(8)6-9/h2*2-5,9H,6H2,1H3.
What are the key properties of 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol?
2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol has a molecular weight of 276.33 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)phenol;(2-methoxyphenyl)methanol is sourced from PubChem (CID 138113041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).