C23H17NO2 — CID 138115649
2,2-diphenyl-3,5-dihydrofuro[3,2-c]quinolin-4-one (PubChem CID 138115649) has the molecular formula C23H17NO2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2,2-diphenyl-3,5-dihydrofuro[3,2-c]quinolin-4-one.
| Compound Name | 2,2-diphenyl-3,5-dihydrofuro[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 138115649 |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2,2-diphenyl-3,5-dihydrofuro[3,2-c]quinolin-4-one |
| SMILES | O=c1[nH]c2ccccc2c2c1CC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C23H17NO2/c25-22-19-15-23(16-9-3-1-4-10-16,17-11-5-2-6-12-17)26-21(19)18-13-7-8-14-20(18)24-22/h1-14H,15H2,(H,24,25) |
| InChIKey | NQJVSDVCFZLINP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |