C35H71NO7P+ — CID 138122316
2-[hydroxy-[2-nonanoyloxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138122316) has the molecular formula C35H71NO7P+ and a molecular weight of 648.93 g/mol. Its IUPAC name is 2-[hydroxy-[2-nonanoyloxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-nonanoyloxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138122316 |
| Molecular Formula | C35H71NO7P+ |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.50 |
| IUPAC Name | 2-[hydroxy-[2-nonanoyloxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C35H70NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-27-30-40-32-34(43-35(37)28-26-24-13-11-9-7-2)33-42-44(38,39)41-31-29-36(3,4)5/h17-18,34H,6-16,19-33H2,1-5H3/p+1/b18-17- |
| InChIKey | AUIULIZEZQMAFU-ZCXUNETKSA-O |
| XLogP | 9.54 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|