C46H72O6 — CID 138123703
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (4Z,7Z)-hexadeca-4,7-dienoate (PubChem CID 138123703) has the molecular formula C46H72O6 and a molecular weight of 721.08 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (4Z,7Z)-hexadeca-4,7-dienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (4Z,7Z)-hexadeca-4,7-dienoate |
|---|---|
| PubChem CID | 138123703 |
| Molecular Formula | C46H72O6 |
| Molecular Weight | 721.08 g/mol |
| Exact Mass | 720.53 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (4Z,7Z)-hexadeca-4,7-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)C/C=C\C/C=C\C/C=C\CC)COC(=O)CC/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H72O6/c1-4-7-10-13-16-19-21-23-25-27-30-33-36-39-45(48)51-42-43(41-50-44(47)38-35-32-29-26-18-15-12-9-6-3)52-46(49)40-37-34-31-28-24-22-20-17-14-11-8-5-2/h8-9,11-12,17-18,20,23-26,28,30,32-33,35,43H,4-7,10,13-16,19,21-22,27,29,31,34,36-42H2,1-3H3/b11-8-,12-9-,20-17-,25-23-,26-18-,28-24-,33-30-,35-32- |
| InChIKey | AYRPNFRFVMJQME-AAGHMVPUSA-N |
| XLogP | 12.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.08 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|