C48H76O6 — CID 138307097
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(4Z,7Z)-hexadeca-4,7-dienoyl]oxypropyl] (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate (PubChem CID 138307097) has the molecular formula C48H76O6 and a molecular weight of 749.13 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(4Z,7Z)-hexadeca-4,7-dienoyl]oxypropyl] (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(4Z,7Z)-hexadeca-4,7-dienoyl]oxypropyl] (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate |
|---|---|
| PubChem CID | 138307097 |
| Molecular Formula | C48H76O6 |
| Molecular Weight | 749.13 g/mol |
| Exact Mass | 748.56 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(4Z,7Z)-hexadeca-4,7-dienoyl]oxypropyl] (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)CC/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C48H76O6/c1-4-7-10-13-16-19-21-23-25-26-29-32-35-38-41-47(50)53-44-45(43-52-46(49)40-37-34-31-28-18-15-12-9-6-3)54-48(51)42-39-36-33-30-27-24-22-20-17-14-11-8-5-2/h7,9-10,12,16,18-19,23-25,27-28,33-34,36-37,45H,4-6,8,11,13-15,17,20-22,26,29-32,35,38-44H2,1-3H3/b10-7-,12-9-,19-16-,25-23-,27-24-,28-18-,36-33-,37-34- |
| InChIKey | YPEBXPWRJHNTBK-OOAKDCMMSA-N |
| XLogP | 13.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.13 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|