C44H74O10 — CID 138125099
[1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate (PubChem CID 138125099) has the molecular formula C44H74O10 and a molecular weight of 763.07 g/mol. Its IUPAC name is [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 138125099 |
| Molecular Formula | C44H74O10 |
| Molecular Weight | 763.07 g/mol |
| Exact Mass | 762.53 |
| IUPAC Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C44H74O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(47)53-37(36-52-44-43(50)42(49)41(48)38(34-45)54-44)35-51-39(46)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,23,25,37-38,41-45,48-50H,3-4,6,8-10,12,14-15,20-22,24,26-36H2,1-2H3/b7-5-,13-11-,18-16-,19-17-,25-23- |
| InChIKey | BCYVGELNSHVBDS-KTLFELONSA-N |
| XLogP | 8.27 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.07 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|