C51H86O10 — CID 138283103
[1-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 138283103) has the molecular formula C51H86O10 and a molecular weight of 859.24 g/mol. Its IUPAC name is [1-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | [1-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 138283103 |
| Molecular Formula | C51H86O10 |
| Molecular Weight | 859.24 g/mol |
| Exact Mass | 858.62 |
| IUPAC Name | [1-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C51H86O10/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-47(54)60-44(43-59-51-50(57)49(56)48(55)45(41-52)61-51)42-58-46(53)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-20,22,24,44-45,48-52,55-57H,3-5,7,9-10,15-16,21,23,25-43H2,1-2H3/b8-6-,13-11-,14-12-,19-17-,20-18-,24-22- |
| InChIKey | VSQAMFDBRKWWRK-UKIWXORGSA-N |
| XLogP | 10.78 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.24 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|