C47H78O6 — CID 138142917
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate (PubChem CID 138142917) has the molecular formula C47H78O6 and a molecular weight of 739.14 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate |
|---|---|
| PubChem CID | 138142917 |
| Molecular Formula | C47H78O6 |
| Molecular Weight | 739.14 g/mol |
| Exact Mass | 738.58 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCCCCCC/C=C\C/C=C\CC)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C47H78O6/c1-4-7-10-13-16-19-21-23-24-26-28-31-34-37-40-46(49)52-43-44(42-51-45(48)39-36-33-30-27-18-15-12-9-6-3)53-47(50)41-38-35-32-29-25-22-20-17-14-11-8-5-2/h7,9-10,12,16-20,27,33,36,44H,4-6,8,11,13-15,21-26,28-32,34-35,37-43H2,1-3H3/b10-7-,12-9-,19-16-,20-17-,27-18-,36-33- |
| InChIKey | DFYOALPWIZYTOW-FYIDIWEKSA-N |
| XLogP | 13.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.14 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|