C46H76O6 — CID 138144084
[2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (6Z,9Z,12Z)-pentadeca-6,9,12-trienoate (PubChem CID 138144084) has the molecular formula C46H76O6 and a molecular weight of 725.11 g/mol. Its IUPAC name is [2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (6Z,9Z,12Z)-pentadeca-6,9,12-trienoate.
| Compound Name | [2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (6Z,9Z,12Z)-pentadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 138144084 |
| Molecular Formula | C46H76O6 |
| Molecular Weight | 725.11 g/mol |
| Exact Mass | 724.56 |
| IUPAC Name | [2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (6Z,9Z,12Z)-pentadeca-6,9,12-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)OC(=O)CCCCC/C=C\C=C/CCCC |
| InChI | InChI=1S/C46H76O6/c1-4-7-10-13-16-19-22-25-27-30-33-36-39-45(48)51-42-43(52-46(49)40-37-34-31-28-24-21-18-15-12-9-6-3)41-50-44(47)38-35-32-29-26-23-20-17-14-11-8-5-2/h7,10,14-19,21,24-25,27,43H,4-6,8-9,11-13,20,22-23,26,28-42H2,1-3H3/b10-7-,17-14-,18-15-,19-16-,24-21-,27-25- |
| InChIKey | DJLZZMPSMDBSRF-FCCVYODWSA-N |
| XLogP | 13.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.11 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|