C46H82NO11P — CID 138150313
[2-[(Z)-7-[6-[(1E,5Z)-3-hydroperoxyocta-1,5-dienyl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138150313) has the molecular formula C46H82NO11P and a molecular weight of 856.13 g/mol. Its IUPAC name is [2-[(Z)-7-[6-[(1E,5Z)-3-hydroperoxyocta-1,5-dienyl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(Z)-7-[6-[(1E,5Z)-3-hydroperoxyocta-1,5-dienyl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138150313 |
| Molecular Formula | C46H82NO11P |
| Molecular Weight | 856.13 g/mol |
| Exact Mass | 855.56 |
| IUPAC Name | [2-[(Z)-7-[6-[(1E,5Z)-3-hydroperoxyocta-1,5-dienyl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\CC(/C=C/C1C2CC(OO2)C1C/C=C\CCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C)OO |
| InChI | InChI=1S/C46H82NO11P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-24-28-35-52-38-41(39-54-59(50,51)53-36-34-47(3,4)5)55-46(48)31-27-23-22-26-30-42-43(45-37-44(42)57-58-45)33-32-40(56-49)29-25-9-7-2/h9,15-16,22,25-26,32-33,40-45H,6-8,10-14,17-21,23-24,27-31,34-39H2,1-5H3,(H-,49,50,51)/b16-15-,25-9-,26-22-,33-32+ |
| InChIKey | FCZCKBZSRUWMFG-KGCICEIGSA-N |
| XLogP | 10.38 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.13 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|