C53H84O6 — CID 138152653
[1-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate (PubChem CID 138152653) has the molecular formula C53H84O6 and a molecular weight of 817.25 g/mol. Its IUPAC name is [1-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate.
| Compound Name | [1-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
|---|---|
| PubChem CID | 138152653 |
| Molecular Formula | C53H84O6 |
| Molecular Weight | 817.25 g/mol |
| Exact Mass | 816.63 |
| IUPAC Name | [1-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C\CCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)OC(=O)CCCCCCCCC/C=C\C=C/C=C\CC |
| InChI | InChI=1S/C53H84O6/c1-4-7-10-13-16-19-22-24-26-28-31-34-37-40-43-46-52(55)58-49-50(48-57-51(54)45-42-39-36-33-30-21-18-15-12-9-6-3)59-53(56)47-44-41-38-35-32-29-27-25-23-20-17-14-11-8-5-2/h7-8,10-11,13-20,22-24,26,28,31,50H,4-6,9,12,21,25,27,29-30,32-49H2,1-3H3/b10-7-,11-8-,16-13-,17-14-,18-15-,22-19-,23-20-,26-24-,31-28- |
| InChIKey | FJZUXGKKNRNQNC-PXEUGZJVSA-N |
| XLogP | 15.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.25 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|