C50H82O6 — CID 138276380
[2-[(Z)-pentadec-9-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoate (PubChem CID 138276380) has the molecular formula C50H82O6 and a molecular weight of 779.20 g/mol. Its IUPAC name is [2-[(Z)-pentadec-9-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoate.
| Compound Name | [2-[(Z)-pentadec-9-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoate |
|---|---|
| PubChem CID | 138276380 |
| Molecular Formula | C50H82O6 |
| Molecular Weight | 779.20 g/mol |
| Exact Mass | 778.61 |
| IUPAC Name | [2-[(Z)-pentadec-9-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C\CCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C50H82O6/c1-4-7-10-13-16-19-22-24-25-26-29-31-34-37-40-43-49(52)55-46-47(45-54-48(51)42-39-36-33-30-27-21-18-15-12-9-6-3)56-50(53)44-41-38-35-32-28-23-20-17-14-11-8-5-2/h7,10,13,15-20,22,24-26,29,47H,4-6,8-9,11-12,14,21,23,27-28,30-46H2,1-3H3/b10-7-,16-13-,18-15-,20-17-,22-19-,25-24-,29-26- |
| InChIKey | UXWFJKAUERVIBD-IRBVHSLBSA-N |
| XLogP | 14.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.20 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|