C55H88O6 — CID 138255254
[2-[(Z)-hexadec-7-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate (PubChem CID 138255254) has the molecular formula C55H88O6 and a molecular weight of 845.30 g/mol. Its IUPAC name is [2-[(Z)-hexadec-7-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate.
| Compound Name | [2-[(Z)-hexadec-7-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate |
|---|---|
| PubChem CID | 138255254 |
| Molecular Formula | C55H88O6 |
| Molecular Weight | 845.30 g/mol |
| Exact Mass | 844.66 |
| IUPAC Name | [2-[(Z)-hexadec-7-enoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C/C=C\C=C/CCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)OC(=O)CCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C55H88O6/c1-4-7-10-13-16-19-22-24-25-26-27-28-29-31-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-32-21-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-30-23-20-17-14-11-8-5-2/h7,10,13,15-16,18-19,22,24-31,33-34,52H,4-6,8-9,11-12,14,17,20-21,23,32,35-51H2,1-3H3/b10-7-,16-13-,18-15-,22-19-,25-24-,27-26+,29-28-,33-31-,34-30- |
| InChIKey | RQXSLMBBZVOADT-PGICEUNPSA-N |
| XLogP | 15.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.30 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|