C37H71NO7P+ — CID 138152731
2-[hydroxy-[3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]-2-nonanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138152731) has the molecular formula C37H71NO7P+ and a molecular weight of 672.95 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]-2-nonanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]-2-nonanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138152731 |
| Molecular Formula | C37H71NO7P+ |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.50 |
| IUPAC Name | 2-[hydroxy-[3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]-2-nonanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C37H70NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-24-25-27-29-32-42-34-36(45-37(39)30-28-26-13-11-9-7-2)35-44-46(40,41)43-33-31-38(3,4)5/h8,10,14-15,17-18,36H,6-7,9,11-13,16,19-35H2,1-5H3/p+1/b10-8-,15-14-,18-17- |
| InChIKey | FKFNEDXHJMQINW-BLMAZVTDSA-O |
| XLogP | 9.87 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|