C43H72O6 — CID 138163942
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-tridec-8-enoyl]oxypropyl] (Z)-pentadec-9-enoate (PubChem CID 138163942) has the molecular formula C43H72O6 and a molecular weight of 685.04 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-tridec-8-enoyl]oxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-tridec-8-enoyl]oxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 138163942 |
| Molecular Formula | C43H72O6 |
| Molecular Weight | 685.04 g/mol |
| Exact Mass | 684.53 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-tridec-8-enoyl]oxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCC)OC(=O)CCCCCC/C=C\CCCC |
| InChI | InChI=1S/C43H72O6/c1-4-7-10-13-16-19-21-22-25-27-30-33-36-42(45)48-39-40(38-47-41(44)35-32-29-26-23-18-15-12-9-6-3)49-43(46)37-34-31-28-24-20-17-14-11-8-5-2/h9,12,14,16-19,23,29,32,40H,4-8,10-11,13,15,20-22,24-28,30-31,33-39H2,1-3H3/b12-9-,17-14-,19-16-,23-18-,32-29- |
| InChIKey | GTGVPTHKRWZCIH-CKTLMWCMSA-N |
| XLogP | 12.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.04 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|