C41H71O13P — CID 138170189
[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] (Z)-hexadec-9-enoate (PubChem CID 138170189) has the molecular formula C41H71O13P and a molecular weight of 802.98 g/mol. Its IUPAC name is [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] (Z)-hexadec-9-enoate.
| Compound Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138170189 |
| Molecular Formula | C41H71O13P |
| Molecular Weight | 802.98 g/mol |
| Exact Mass | 802.46 |
| IUPAC Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] (Z)-hexadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C41H71O13P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(42)51-31-33(32-52-55(49,50)54-41-39(47)37(45)36(44)38(46)40(41)48)53-35(43)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12-15,18,20,33,36-41,44-48H,3-5,7,9-11,16-17,19,21-32H2,1-2H3,(H,49,50)/b8-6-,14-12-,15-13-,20-18- |
| InChIKey | HMVVXPLKDSHJJC-JETZYGMFSA-N |
| XLogP | 6.83 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.98 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|