C32H62N2O6P+ — CID 138178079
2-[[(4E,8E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxypentadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138178079) has the molecular formula C32H62N2O6P+ and a molecular weight of 601.83 g/mol. Its IUPAC name is 2-[[(4E,8E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxypentadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxypentadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138178079 |
| Molecular Formula | C32H62N2O6P+ |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 601.43 |
| IUPAC Name | 2-[[(4E,8E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxypentadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCC |
| InChI | InChI=1S/C32H61N2O6P/c1-6-8-10-12-14-16-18-19-21-23-25-31(35)30(29-40-41(37,38)39-28-27-34(3,4)5)33-32(36)26-24-22-20-17-15-13-11-9-7-2/h16-18,20,23,25,30-31,35H,6-15,19,21-22,24,26-29H2,1-5H3,(H-,33,36,37,38)/p+1/b18-16+,20-17-,25-23+ |
| InChIKey | ILGJSZBQROTNDY-MBMKGBMESA-O |
| XLogP | 7.23 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|