C40H76N2O6P+ — CID 138194713
2-[[(4E,8E,12E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxytricosa-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138194713) has the molecular formula C40H76N2O6P+ and a molecular weight of 712.03 g/mol. Its IUPAC name is 2-[[(4E,8E,12E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxytricosa-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E,12E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxytricosa-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138194713 |
| Molecular Formula | C40H76N2O6P+ |
| Molecular Weight | 712.03 g/mol |
| Exact Mass | 711.54 |
| IUPAC Name | 2-[[(4E,8E,12E)-2-[[(Z)-dodec-5-enoyl]amino]-3-hydroxytricosa-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C40H75N2O6P/c1-6-8-10-12-14-16-17-18-19-20-21-22-23-24-26-27-29-31-33-39(43)38(37-48-49(45,46)47-36-35-42(3,4)5)41-40(44)34-32-30-28-25-15-13-11-9-7-2/h20-21,24-26,28,31,33,38-39,43H,6-19,22-23,27,29-30,32,34-37H2,1-5H3,(H-,41,44,45,46)/p+1/b21-20+,26-24+,28-25-,33-31+ |
| InChIKey | KKWMOKHUZWDXLE-PHCMHQPISA-O |
| XLogP | 10.13 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.03 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|