C27H46O10 — CID 138179367
[1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 138179367) has the molecular formula C27H46O10 and a molecular weight of 530.66 g/mol. Its IUPAC name is [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138179367 |
| Molecular Formula | C27H46O10 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(C)=O)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C27H46O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23(30)36-21(18-34-20(2)29)19-35-27-26(33)25(32)24(31)22(17-28)37-27/h5-6,8-9,21-22,24-28,31-33H,3-4,7,10-19H2,1-2H3/b6-5-,9-8- |
| InChIKey | IPHZHKFYVQNZPM-AFJQJTPPSA-N |
| XLogP | 2.31 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|