C32H58O10 — CID 138296807
[1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate (PubChem CID 138296807) has the molecular formula C32H58O10 and a molecular weight of 602.81 g/mol. Its IUPAC name is [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate.
| Compound Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138296807 |
| Molecular Formula | C32H58O10 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COC(C)=O)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C32H58O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(35)41-26(23-39-25(2)34)24-40-32-31(38)30(37)29(36)27(22-33)42-32/h11-12,26-27,29-33,36-38H,3-10,13-24H2,1-2H3/b12-11- |
| InChIKey | XJIWOAFGFPQWJY-QXMHVHEDSA-N |
| XLogP | 4.49 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|