C27H46O5 — CID 138190308
(1-hexanoyloxy-3-hydroxypropan-2-yl) (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 138190308) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is (1-hexanoyloxy-3-hydroxypropan-2-yl) (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | (1-hexanoyloxy-3-hydroxypropan-2-yl) (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 138190308 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | (1-hexanoyloxy-3-hydroxypropan-2-yl) (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CO)COC(=O)CCCCC |
| InChI | InChI=1S/C27H46O5/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20-22-27(30)32-25(23-28)24-31-26(29)21-19-6-4-2/h5,7,9-10,12-13,25,28H,3-4,6,8,11,14-24H2,1-2H3/b7-5-,10-9-,13-12- |
| InChIKey | JXEBVNHLOJFIMV-XQOKXTRKSA-N |
| XLogP | 6.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|