C45H74O6 — CID 138194572
[3-[(Z)-dodec-5-enoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (9Z,11Z,13Z)-hexadeca-9,11,13-trienoate (PubChem CID 138194572) has the molecular formula C45H74O6 and a molecular weight of 711.08 g/mol. Its IUPAC name is [3-[(Z)-dodec-5-enoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (9Z,11Z,13Z)-hexadeca-9,11,13-trienoate.
| Compound Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (9Z,11Z,13Z)-hexadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 138194572 |
| Molecular Formula | C45H74O6 |
| Molecular Weight | 711.08 g/mol |
| Exact Mass | 710.55 |
| IUPAC Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (9Z,11Z,13Z)-hexadeca-9,11,13-trienoate |
| SMILES | CC/C=C\C=C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC/C=C\CCCCCC)OC(=O)CCCCC/C=C\C=C/CCCC |
| InChI | InChI=1S/C45H74O6/c1-4-7-10-13-16-19-21-22-24-26-29-32-35-38-44(47)50-41-42(40-49-43(46)37-34-31-28-25-18-15-12-9-6-3)51-45(48)39-36-33-30-27-23-20-17-14-11-8-5-2/h7,10,13-14,16-17,19-21,23,25,28,42H,4-6,8-9,11-12,15,18,22,24,26-27,29-41H2,1-3H3/b10-7-,16-13-,17-14-,21-19-,23-20-,28-25- |
| InChIKey | KKLXLCGWIOAZJA-RMRRIEMDSA-N |
| XLogP | 12.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.08 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|