C54H88O6 — CID 138140383
[2-[(7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate (PubChem CID 138140383) has the molecular formula C54H88O6 and a molecular weight of 833.29 g/mol. Its IUPAC name is [2-[(7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate.
| Compound Name | [2-[(7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
|---|---|
| PubChem CID | 138140383 |
| Molecular Formula | C54H88O6 |
| Molecular Weight | 833.29 g/mol |
| Exact Mass | 832.66 |
| IUPAC Name | [2-[(7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\C=C/C=C\CCCCCCC)COC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C54H88O6/c1-4-7-10-13-16-19-22-24-25-26-27-28-30-32-35-38-41-44-47-53(56)59-50-51(49-58-52(55)46-43-40-37-34-31-21-18-15-12-9-6-3)60-54(57)48-45-42-39-36-33-29-23-20-17-14-11-8-5-2/h8,11,14-15,17-18,20,22-29,33,51H,4-7,9-10,12-13,16,19,21,30-32,34-50H2,1-3H3/b11-8-,17-14-,18-15-,23-20-,24-22-,26-25-,28-27-,33-29- |
| InChIKey | CYIZDHSCIASREG-AYSJMOLCSA-N |
| XLogP | 15.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.29 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|