C37H60O15 — CID 138196594
[1-hexanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate (PubChem CID 138196594) has the molecular formula C37H60O15 and a molecular weight of 744.87 g/mol. Its IUPAC name is [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate.
| Compound Name | [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 138196594 |
| Molecular Formula | C37H60O15 |
| Molecular Weight | 744.87 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCC)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C37H60O15/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-29(40)50-25(22-47-28(39)19-17-6-4-2)23-48-36-35(46)33(44)31(42)27(52-36)24-49-37-34(45)32(43)30(41)26(21-38)51-37/h5,7,9-10,12-13,15-16,25-27,30-38,41-46H,3-4,6,8,11,14,17-24H2,1-2H3/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | KQUIPRZBVRGUBM-KUXGPOOQSA-N |
| XLogP | 1.25 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.87 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|