C40H66O15 — CID 138220891
[1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate (PubChem CID 138220891) has the molecular formula C40H66O15 and a molecular weight of 786.95 g/mol. Its IUPAC name is [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate.
| Compound Name | [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 138220891 |
| Molecular Formula | C40H66O15 |
| Molecular Weight | 786.95 g/mol |
| Exact Mass | 786.44 |
| IUPAC Name | [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCCCCC)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C40H66O15/c1-3-5-7-9-11-12-13-14-15-16-17-19-21-23-32(43)53-28(25-50-31(42)22-20-18-10-8-6-4-2)26-51-39-38(49)36(47)34(45)30(55-39)27-52-40-37(48)35(46)33(44)29(24-41)54-40/h5,7,11-12,14-15,17,19,28-30,33-41,44-49H,3-4,6,8-10,13,16,18,20-27H2,1-2H3/b7-5-,12-11-,15-14-,19-17- |
| InChIKey | NOHPBZPDGJTDIO-TZYWDAKQSA-N |
| XLogP | 2.42 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.95 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|