C34H64NO8P — CID 138199317
[3-hexanoyloxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138199317) has the molecular formula C34H64NO8P and a molecular weight of 645.86 g/mol. Its IUPAC name is [3-hexanoyloxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-hexanoyloxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138199317 |
| Molecular Formula | C34H64NO8P |
| Molecular Weight | 645.86 g/mol |
| Exact Mass | 645.44 |
| IUPAC Name | [3-hexanoyloxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C34H64NO8P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-27-34(37)43-32(30-40-33(36)26-24-9-7-2)31-42-44(38,39)41-29-28-35(3,4)5/h12-13,15-16,32H,6-11,14,17-31H2,1-5H3/b13-12-,16-15- |
| InChIKey | KZFLZVFRHLOJND-QGLGPCELSA-N |
| XLogP | 7.82 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.86 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|