C31H57O8P — CID 138204047
[3-[ethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-tridec-9-enoyl]oxypropyl] (Z)-tridec-9-enoate (PubChem CID 138204047) has the molecular formula C31H57O8P and a molecular weight of 588.76 g/mol. Its IUPAC name is [3-[ethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-tridec-9-enoyl]oxypropyl] (Z)-tridec-9-enoate.
| Compound Name | [3-[ethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-tridec-9-enoyl]oxypropyl] (Z)-tridec-9-enoate |
|---|---|
| PubChem CID | 138204047 |
| Molecular Formula | C31H57O8P |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | [3-[ethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-tridec-9-enoyl]oxypropyl] (Z)-tridec-9-enoate |
| SMILES | CCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCC)OC(=O)CCCCCCC/C=C\CCC |
| InChI | InChI=1S/C31H57O8P/c1-4-7-9-11-13-15-17-19-21-23-25-30(32)36-27-29(28-38-40(34,35)37-6-3)39-31(33)26-24-22-20-18-16-14-12-10-8-5-2/h9-12,29H,4-8,13-28H2,1-3H3,(H,34,35)/b11-9-,12-10- |
| InChIKey | LOALTXCLLHXQDH-HWAYABPNSA-N |
| XLogP | 8.77 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|