C32H59O8P — CID 154815621
[(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-[(E)-tridec-9-enoyl]oxypropan-2-yl] (Z)-tetradec-9-enoate (PubChem CID 154815621) has the molecular formula C32H59O8P and a molecular weight of 602.79 g/mol. Its IUPAC name is [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-[(E)-tridec-9-enoyl]oxypropan-2-yl] (Z)-tetradec-9-enoate.
| Compound Name | [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-[(E)-tridec-9-enoyl]oxypropan-2-yl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 154815621 |
| Molecular Formula | C32H59O8P |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-[(E)-tridec-9-enoyl]oxypropan-2-yl] (Z)-tetradec-9-enoate |
| SMILES | CCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC)OC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C32H59O8P/c1-4-7-9-11-13-15-17-19-21-23-25-27-32(34)40-30(29-39-41(35,36)38-6-3)28-37-31(33)26-24-22-20-18-16-14-12-10-8-5-2/h10-13,30H,4-9,14-29H2,1-3H3,(H,35,36)/b12-10+,13-11-/t30-/m1/s1 |
| InChIKey | ZAZJEFMXXINDCY-DGXBNBJFSA-N |
| XLogP | 9.16 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|