C19H35NO7 — CID 138205031
4-(3-butanoyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate (PubChem CID 138205031) has the molecular formula C19H35NO7 and a molecular weight of 389.49 g/mol. Its IUPAC name is 4-(3-butanoyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-(3-butanoyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138205031 |
| Molecular Formula | C19H35NO7 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 4-(3-butanoyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCC |
| InChI | InChI=1S/C19H35NO7/c1-6-8-10-18(22)27-15(14-26-17(21)9-7-2)13-25-12-11-16(19(23)24)20(3,4)5/h15-16H,6-14H2,1-5H3 |
| InChIKey | LRBSTMVVVHGNQI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|