C20H37NO7 — CID 138225319
4-[2,3-di(pentanoyloxy)propoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 138225319) has the molecular formula C20H37NO7 and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-[2,3-di(pentanoyloxy)propoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2,3-di(pentanoyloxy)propoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138225319 |
| Molecular Formula | C20H37NO7 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 4-[2,3-di(pentanoyloxy)propoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCC |
| InChI | InChI=1S/C20H37NO7/c1-6-8-10-18(22)27-15-16(28-19(23)11-9-7-2)14-26-13-12-17(20(24)25)21(3,4)5/h16-17H,6-15H2,1-5H3 |
| InChIKey | OCDBSGDYYVATMT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|