C40H75O13P — CID 138207959
[1-decanoyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (Z)-henicos-11-enoate (PubChem CID 138207959) has the molecular formula C40H75O13P and a molecular weight of 795.00 g/mol. Its IUPAC name is [1-decanoyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (Z)-henicos-11-enoate.
| Compound Name | [1-decanoyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138207959 |
| Molecular Formula | C40H75O13P |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.49 |
| IUPAC Name | [1-decanoyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (Z)-henicos-11-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C40H75O13P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-27-29-34(42)52-32(30-50-33(41)28-26-24-22-10-8-6-4-2)31-51-54(48,49)53-40-38(46)36(44)35(43)37(45)39(40)47/h15-16,32,35-40,43-47H,3-14,17-31H2,1-2H3,(H,48,49)/b16-15- |
| InChIKey | LZXBYIKMNILUKK-NXVVXOECSA-N |
| XLogP | 7.11 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|