C40H77NO7P+ — CID 138220219
2-[[2-decanoyloxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138220219) has the molecular formula C40H77NO7P+ and a molecular weight of 715.03 g/mol. Its IUPAC name is 2-[[2-decanoyloxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-decanoyloxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138220219 |
| Molecular Formula | C40H77NO7P+ |
| Molecular Weight | 715.03 g/mol |
| Exact Mass | 714.54 |
| IUPAC Name | 2-[[2-decanoyloxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C40H76NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-24-25-26-28-30-32-35-45-37-39(38-47-49(43,44)46-36-34-41(3,4)5)48-40(42)33-31-29-27-13-11-9-7-2/h14-15,17-18,20-21,39H,6-13,16,19,22-38H2,1-5H3/p+1/b15-14-,18-17-,21-20- |
| InChIKey | NMEPONGKLFLBMF-SKFHMOIXSA-O |
| XLogP | 11.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.03 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|