C47H91NO7P+ — CID 165193307
2-[hydroxy-[2-[(Z)-icos-11-enoyl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165193307) has the molecular formula C47H91NO7P+ and a molecular weight of 813.22 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(Z)-icos-11-enoyl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(Z)-icos-11-enoyl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165193307 |
| Molecular Formula | C47H91NO7P+ |
| Molecular Weight | 813.22 g/mol |
| Exact Mass | 812.65 |
| IUPAC Name | 2-[hydroxy-[2-[(Z)-icos-11-enoyl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C47H90NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-47(49)55-46(45-54-56(50,51)53-43-41-48(3,4)5)44-52-42-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h17,19-20,22-23,25,46H,6-16,18,21,24,26-45H2,1-5H3/p+1/b19-17-,22-20-,25-23- |
| InChIKey | BYHFDZZSAQAPLE-BTWYKXKQSA-O |
| XLogP | 13.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.22 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|