C42H81N2O6P — CID 138220329
[(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138220329) has the molecular formula C42H81N2O6P and a molecular weight of 741.09 g/mol. Its IUPAC name is [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138220329 |
| Molecular Formula | C42H81N2O6P |
| Molecular Weight | 741.09 g/mol |
| Exact Mass | 740.58 |
| IUPAC Name | [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C42H81N2O6P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-34-36-42(46)43-40(39-50-51(47,48)49-38-37-44(3,4)5)41(45)35-33-31-29-27-25-23-19-17-15-13-11-9-7-2/h21-22,25,27,33,35,40-41,45H,6-20,23-24,26,28-32,34,36-39H2,1-5H3,(H-,43,46,47,48)/b22-21-,27-25+,35-33+ |
| InChIKey | NMNDROJBIGXDOC-SWIHOKPWSA-N |
| XLogP | 10.50 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.09 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|