C41H79N2O6P — CID 138235484
[(4E,8E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138235484) has the molecular formula C41H79N2O6P and a molecular weight of 727.06 g/mol. Its IUPAC name is [(4E,8E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138235484 |
| Molecular Formula | C41H79N2O6P |
| Molecular Weight | 727.06 g/mol |
| Exact Mass | 726.57 |
| IUPAC Name | [(4E,8E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C41H79N2O6P/c1-6-8-10-12-14-16-18-20-21-23-25-27-29-31-33-35-41(45)42-39(38-49-50(46,47)48-37-36-43(3,4)5)40(44)34-32-30-28-26-24-22-19-17-15-13-11-9-7-2/h16,18,24,26,32,34,39-40,44H,6-15,17,19-23,25,27-31,33,35-38H2,1-5H3,(H-,42,45,46,47)/b18-16-,26-24+,34-32+ |
| InChIKey | PHUNHHQMSABGSN-LBSJLUOHSA-N |
| XLogP | 10.11 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.06 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|