C42H78NO13P — CID 138237119
2-amino-3-[hydroxy-[3-[(Z)-octadec-9-enoyl]oxy-2-[(E)-9,12,13-trihydroxyoctadec-10-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 138237119) has the molecular formula C42H78NO13P and a molecular weight of 836.05 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[3-[(Z)-octadec-9-enoyl]oxy-2-[(E)-9,12,13-trihydroxyoctadec-10-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[3-[(Z)-octadec-9-enoyl]oxy-2-[(E)-9,12,13-trihydroxyoctadec-10-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138237119 |
| Molecular Formula | C42H78NO13P |
| Molecular Weight | 836.05 g/mol |
| Exact Mass | 835.52 |
| IUPAC Name | 2-amino-3-[hydroxy-[3-[(Z)-octadec-9-enoyl]oxy-2-[(E)-9,12,13-trihydroxyoctadec-10-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC(O)/C=C/C(O)C(O)CCCCC |
| InChI | InChI=1S/C42H78NO13P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-20-24-28-40(47)53-32-36(33-54-57(51,52)55-34-37(43)42(49)50)56-41(48)29-25-21-18-19-23-26-35(44)30-31-39(46)38(45)27-22-6-4-2/h12-13,30-31,35-39,44-46H,3-11,14-29,32-34,43H2,1-2H3,(H,49,50)(H,51,52)/b13-12-,31-30+ |
| InChIKey | PMULJAWIDGJSHG-JOWYLZJISA-N |
| XLogP | 7.97 |
| TPSA | 232.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.05 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|