C36H58O4 — CID 138242491
(11Z,14Z,17Z)-10-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxyicosa-11,14,17-trienoic acid (PubChem CID 138242491) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is (11Z,14Z,17Z)-10-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxyicosa-11,14,17-trienoic acid.
| Compound Name | (11Z,14Z,17Z)-10-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxyicosa-11,14,17-trienoic acid |
|---|---|
| PubChem CID | 138242491 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | (11Z,14Z,17Z)-10-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxyicosa-11,14,17-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(/C=C\C/C=C\C/C=C\CC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C36H58O4/c1-3-5-7-9-11-13-14-15-16-17-19-25-29-33-36(39)40-34(30-26-22-18-12-10-8-6-4-2)31-27-23-20-21-24-28-32-35(37)38/h5-8,11-13,15-16,18,26,30,34H,3-4,9-10,14,17,19-25,27-29,31-33H2,1-2H3,(H,37,38)/b7-5-,8-6-,13-11-,16-15-,18-12-,30-26- |
| InChIKey | QDCXTLKWQHUKLC-AWVDHKAESA-N |
| XLogP | 10.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|