C38H60O4 — CID 138235264
(11Z,14Z,17Z)-10-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyicosa-11,14,17-trienoic acid (PubChem CID 138235264) has the molecular formula C38H60O4 and a molecular weight of 580.89 g/mol. Its IUPAC name is (11Z,14Z,17Z)-10-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyicosa-11,14,17-trienoic acid.
| Compound Name | (11Z,14Z,17Z)-10-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyicosa-11,14,17-trienoic acid |
|---|---|
| PubChem CID | 138235264 |
| Molecular Formula | C38H60O4 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | (11Z,14Z,17Z)-10-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyicosa-11,14,17-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(/C=C\C/C=C\C/C=C\CC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H60O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-27-31-35-38(41)42-36(32-28-24-20-12-10-8-6-4-2)33-29-25-22-23-26-30-34-37(39)40/h5-8,11-13,15-16,18-20,28,32,36H,3-4,9-10,14,17,21-27,29-31,33-35H2,1-2H3,(H,39,40)/b7-5-,8-6-,13-11-,16-15-,19-18-,20-12-,32-28- |
| InChIKey | PHEIFXFULDYQME-AHFWYMCUSA-N |
| XLogP | 11.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|