C39H66O4 — CID 138315352
(11Z,14Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyhenicosa-11,14-dienoic acid (PubChem CID 138315352) has the molecular formula C39H66O4 and a molecular weight of 598.95 g/mol. Its IUPAC name is (11Z,14Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyhenicosa-11,14-dienoic acid.
| Compound Name | (11Z,14Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyhenicosa-11,14-dienoic acid |
|---|---|
| PubChem CID | 138315352 |
| Molecular Formula | C39H66O4 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.50 |
| IUPAC Name | (11Z,14Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyhenicosa-11,14-dienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(/C=C\C/C=C\CCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C39H66O4/c1-3-5-7-9-11-13-14-15-16-17-18-20-22-28-32-36-39(42)43-37(33-29-25-21-19-12-10-8-6-4-2)34-30-26-23-24-27-31-35-38(40)41/h5,7,11,13,15-16,19,21,29,33,37H,3-4,6,8-10,12,14,17-18,20,22-28,30-32,34-36H2,1-2H3,(H,40,41)/b7-5-,13-11-,16-15-,21-19-,33-29- |
| InChIKey | ZOTOTFRGINWMRT-GZGDWNBFSA-N |
| XLogP | 12.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|