C38H66O4 — CID 138209915
(Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyicos-11-enoic acid (PubChem CID 138209915) has the molecular formula C38H66O4 and a molecular weight of 586.94 g/mol. Its IUPAC name is (Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyicos-11-enoic acid.
| Compound Name | (Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyicos-11-enoic acid |
|---|---|
| PubChem CID | 138209915 |
| Molecular Formula | C38H66O4 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 586.50 |
| IUPAC Name | (Z)-10-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyicos-11-enoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(/C=C\CCCCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H66O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-27-31-35-38(41)42-36(32-28-24-20-12-10-8-6-4-2)33-29-25-22-23-26-30-34-37(39)40/h5,7,11,13,15-16,28,32,36H,3-4,6,8-10,12,14,17-27,29-31,33-35H2,1-2H3,(H,39,40)/b7-5-,13-11-,16-15-,32-28- |
| InChIKey | MGCSURXKLCGEGI-CSACILJASA-N |
| XLogP | 12.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|